ChemNet > CAS > 175278-51-0 3-{2-[(4-klórfenil)tio]-5-nitrofenil}akrilsav
175278-51-0 3-{2-[(4-klórfenil)tio]-5-nitrofenil}akrilsav
termék neve |
3-{2-[(4-klórfenil)tio]-5-nitrofenil}akrilsav |
Szinonimák |
; 3-[2-[(4-klórfenil)tio]-5-nitrofenil]akrilsav; (2Z)-3-{2-[(4-klórfenil)szulfanil]-5-nitrofenil}prop-2-énsav |
Angol név |
3-{2-[(4-chlorophenyl)thio]-5-nitrophenyl}acrylic acid; 3-[2-[(4-Chlorophenyl)thio]-5-nitrophenyl]acrylic acid; (2Z)-3-{2-[(4-chlorophenyl)sulfanyl]-5-nitrophenyl}prop-2-enoic acid |
MF |
C15H10ClNO4S |
Molekulatömeg |
335.7622 |
InChI |
InChI=1/C15H10ClNO4S/c16-11-2-5-13(6-3-11)22-14-7-4-12(17(20)21)9-10(14)1-8-15(18)19/h1-9H,(H,18,19)/b8-1- |
CAS-szám |
175278-51-0 |
Molekuláris szerkezete |
|
Sűrűség |
1.5g/cm3 |
Olvadáspont |
212℃ |
Forráspont |
531.7°C at 760 mmHg |
Törésmutató |
1.694 |
Gyulladáspont |
275.4°C |
Gőznyomás |
3.9E-12mmHg at 25°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|